CAS 188416-29-7 appears in our catalog under these names: (±)-Voriconazole, (±)-Voriconazole, 99.06%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10000mg, 5000mg, 100 mg, 10 mg, 50 mg, 5 mg, 25 mg.
(2S,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 188416-29-7) is a chemical compound with the molecular formula C16H14F3N5O and a molecular weight of 349.31 g/mol. IUPAC name: (2S,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: BCEHBSKCWLPMDN-HWPZZCPQSA-N.
| Molecular formula | C16H14F3N5O |
|---|---|
| Molecular weight | 349.31 g/mol |
| IUPAC name | (2S,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | BCEHBSKCWLPMDN-HWPZZCPQSA-N |
| SMILES | C[C@H](C1=NC=NC=C1F)[C@@](CN2C=NC=N2)(C3=C(C=C(C=C3)F)F)O |
Computed by PubChem (NCBI)