CAS 239807-03-5 appears in our catalog under these names: Voriconazole Impurity 8, Voriconazole Impurity 7, Voriconazole Impurity 11. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 239807-03-5) is a chemical compound with the molecular formula C16H14F3N5O and a molecular weight of 349.31 g/mol. IUPAC name: (2R,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: BCEHBSKCWLPMDN-QLJPJBMISA-N.
| Molecular formula | C16H14F3N5O |
|---|---|
| Molecular weight | 349.31 g/mol |
| IUPAC name | (2R,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | BCEHBSKCWLPMDN-QLJPJBMISA-N |
| SMILES | C[C@H](C1=NC=NC=C1F)[C@](CN2C=NC=N2)(C3=C(C=C(C=C3)F)F)O |
Computed by PubChem (NCBI)