Products 1822460-56-9

CAS 1822460-56-9 is the registry number for Benzyl ((4-hydroxyazepan-4-yl)methyl)carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(4-hydroxyazepan-4-yl)methyl]carbamate;hydrochloride (CAS 1822460-56-9) is a chemical compound with the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. IUPAC name: benzyl N-[(4-hydroxyazepan-4-yl)methyl]carbamate;hydrochloride. InChIKey: BCJYBKZHYRWDFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23ClN2O3
Molecular weight314.81 g/mol
IUPAC namebenzyl N-[(4-hydroxyazepan-4-yl)methyl]carbamate;hydrochloride
InChIKeyBCJYBKZHYRWDFJ-UHFFFAOYSA-N
SMILESC1CC(CCNC1)(CNC(=O)OCC2=CC=CC=C2)O.Cl

Computed by PubChem (NCBI)