Products 1823418-18-3

CAS 1823418-18-3 is the registry number for Benzyl ((3-hydroxyazepan-3-yl)methyl)carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(3-hydroxyazepan-3-yl)methyl]carbamate;hydrochloride (CAS 1823418-18-3) is a chemical compound with the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. IUPAC name: benzyl N-[(3-hydroxyazepan-3-yl)methyl]carbamate;hydrochloride. InChIKey: HBBMLXUMUIRZRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23ClN2O3
Molecular weight314.81 g/mol
IUPAC namebenzyl N-[(3-hydroxyazepan-3-yl)methyl]carbamate;hydrochloride
InChIKeyHBBMLXUMUIRZRZ-UHFFFAOYSA-N
SMILESC1CCNCC(C1)(CNC(=O)OCC2=CC=CC=C2)O.Cl

Computed by PubChem (NCBI)