Products 76219-69-7
CAS 76219-69-7 is the registry number for L-Leucyl-L-phenylalanine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoic acid;hydrochloride (CAS 76219-69-7) is a chemical compound with the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoic acid;hydrochloride. InChIKey: WJLAWCQYWSKZRU-QNTKWALQSA-N.
| Molecular formula | C15H23ClN2O3 |
|---|---|
| Molecular weight | 314.81 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoic acid;hydrochloride |
| InChIKey | WJLAWCQYWSKZRU-QNTKWALQSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-Leucyl-L-phenylalanine hydrochloride