Products 1822675-33-1
CAS 1822675-33-1 is the registry number for 2,2-Difluoro-1-(2-fluoro-4-methylphenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2,2-difluoro-1-(2-fluoro-4-methylphenyl)ethanone (CAS 1822675-33-1) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 2,2-difluoro-1-(2-fluoro-4-methylphenyl)ethanone. InChIKey: QZUKOLRPRGRSPC-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 2,2-difluoro-1-(2-fluoro-4-methylphenyl)ethanone |
| InChIKey | QZUKOLRPRGRSPC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C(F)F)F |
Computed by PubChem (NCBI)