CAS 235101-46-9 appears in our catalog under these names: Riluzole Impurity 11, 7-(Trifluoromethoxy)benzo(D)thiazol-2-amine. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
7-(trifluoromethoxy)-1,3-benzothiazol-2-amine (CAS 235101-46-9) is a chemical compound with the molecular formula C8H5F3N2OS and a molecular weight of 234.20 g/mol. IUPAC name: 7-(trifluoromethoxy)-1,3-benzothiazol-2-amine. InChIKey: NZQIJGFXZPVDOA-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2OS |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 7-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| InChIKey | NZQIJGFXZPVDOA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OC(F)(F)F)SC(=N2)N |
Computed by PubChem (NCBI)