CAS 1822845-57-7 is the registry number for 4-Chloro-3-thiocyanato-benzoic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Ethyl 4-chloro-3-thiocyanatobenzoate (CAS 1822845-57-7) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: ethyl 4-chloro-3-thiocyanatobenzoate. InChIKey: RXHHQCIVMUFZRK-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | ethyl 4-chloro-3-thiocyanatobenzoate |
| InChIKey | RXHHQCIVMUFZRK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Cl)SC#N |
Computed by PubChem (NCBI)