Products 1822859-17-5
CAS 1822859-17-5 is the registry number for Tert-butyl 2-bromo-4,4-dimethyl-4H-pyrrolo(3,4-d)thiazole-5(6H)-carboxylate. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
Tert-butyl 2-bromo-4,4-dimethyl-6H-pyrrolo[3,4-d][1,3]thiazole-5-carboxylate (CAS 1822859-17-5) is a chemical compound with the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. IUPAC name: tert-butyl 2-bromo-4,4-dimethyl-6H-pyrrolo[3,4-d][1,3]thiazole-5-carboxylate. InChIKey: DWXGNYKLIYPWHF-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O2S |
|---|---|
| Molecular weight | 333.25 g/mol |
| IUPAC name | tert-butyl 2-bromo-4,4-dimethyl-6H-pyrrolo[3,4-d][1,3]thiazole-5-carboxylate |
| InChIKey | DWXGNYKLIYPWHF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CN1C(=O)OC(C)(C)C)SC(=N2)Br)C |
Computed by PubChem (NCBI)