CAS 1822867-24-2 is the registry number for 3,3'-(Ethane-1,2-diyl)bis(furan-2,5-dione). Offered by: TRC. Available pack sizes: 100mg.
3-[2-(2,5-dioxofuran-3-yl)ethyl]furan-2,5-dione (CAS 1822867-24-2) is a chemical compound with the molecular formula C10H6O6 and a molecular weight of 222.15 g/mol. IUPAC name: 3-[2-(2,5-dioxofuran-3-yl)ethyl]furan-2,5-dione. InChIKey: JUPGSECRPJCODG-UHFFFAOYSA-N.
| Molecular formula | C10H6O6 |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | 3-[2-(2,5-dioxofuran-3-yl)ethyl]furan-2,5-dione |
| InChIKey | JUPGSECRPJCODG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)OC1=O)CCC2=CC(=O)OC2=O |
Computed by PubChem (NCBI)