CAS 64395-07-9 appears in our catalog under these names: 6,8-Dihydro-8-oxoisobenzofuro[5,4-d][1,3]dioxole-6-carboxylic acid, 90%, 8-Oxo-6,8-dihydro-(1,3)dioxolo(4,5-e)isobenzofuran-6-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
8-oxo-6H-furo[3,4-g][1,3]benzodioxole-6-carboxylic acid (CAS 64395-07-9) is a chemical compound with the molecular formula C10H6O6 and a molecular weight of 222.15 g/mol. IUPAC name: 8-oxo-6H-furo[3,4-g][1,3]benzodioxole-6-carboxylic acid. InChIKey: PWOIDDQLLSCXSR-UHFFFAOYSA-N.
| Molecular formula | C10H6O6 |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | 8-oxo-6H-furo[3,4-g][1,3]benzodioxole-6-carboxylic acid |
| InChIKey | PWOIDDQLLSCXSR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C3=C(C=C2)C(OC3=O)C(=O)O |
Computed by PubChem (NCBI)