CAS 2473-16-7 is the registry number for 2,5,7,8-Tetrahydroxy-1,4-Naphthalenedione. Offered by: TRC. Available pack sizes: 25mg.
4,5,7,8-tetrahydroxynaphthalene-1,2-dione (CAS 2473-16-7) is a chemical compound with the molecular formula C10H6O6 and a molecular weight of 222.15 g/mol. IUPAC name: 4,5,7,8-tetrahydroxynaphthalene-1,2-dione. InChIKey: PEEIVTDTCNXCLB-UHFFFAOYSA-N.
| Molecular formula | C10H6O6 |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | 4,5,7,8-tetrahydroxynaphthalene-1,2-dione |
| InChIKey | PEEIVTDTCNXCLB-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1O)O)C(=O)C(=O)C=C2O)O |
Computed by PubChem (NCBI)