Products 182287-47-4

CAS 182287-47-4 is the registry number for 2-((tert-Butoxycarbonyl)amino)-3-cycloheptylpropanoic acid, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3-cycloheptyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 182287-47-4) is a chemical compound with the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. IUPAC name: 3-cycloheptyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VOWHRWIHHWPAFP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H27NO4
Molecular weight285.38 g/mol
IUPAC name3-cycloheptyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
InChIKeyVOWHRWIHHWPAFP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC1CCCCCC1)C(=O)O

Computed by PubChem (NCBI)