CAS 1822986-87-7 is the registry number for Dimethyl 2-(1-aminoethyl)malonate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Dimethyl 2-(1-aminoethyl)propanedioate;hydrochloride (CAS 1822986-87-7) is a chemical compound with the molecular formula C7H14ClNO4 and a molecular weight of 211.64 g/mol. IUPAC name: dimethyl 2-(1-aminoethyl)propanedioate;hydrochloride. InChIKey: FEEDHTIITGXWFJ-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | dimethyl 2-(1-aminoethyl)propanedioate;hydrochloride |
| InChIKey | FEEDHTIITGXWFJ-UHFFFAOYSA-N |
| SMILES | CC(C(C(=O)OC)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)