Products 1822986-87-7

CAS 1822986-87-7 is the registry number for Dimethyl 2-(1-aminoethyl)malonate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

Dimethyl 2-(1-aminoethyl)propanedioate;hydrochloride (CAS 1822986-87-7) is a chemical compound with the molecular formula C7H14ClNO4 and a molecular weight of 211.64 g/mol. IUPAC name: dimethyl 2-(1-aminoethyl)propanedioate;hydrochloride. InChIKey: FEEDHTIITGXWFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO4
Molecular weight211.64 g/mol
IUPAC namedimethyl 2-(1-aminoethyl)propanedioate;hydrochloride
InChIKeyFEEDHTIITGXWFJ-UHFFFAOYSA-N
SMILESCC(C(C(=O)OC)C(=O)OC)N.Cl

Computed by PubChem (NCBI)