CAS 1909319-97-6 appears in our catalog under these names: 4-Aminoheptanedioic acid hydrochloride, 95%, 4-Aminoheptanedioic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-aminoheptanedioic acid;hydrochloride (CAS 1909319-97-6) is a chemical compound with the molecular formula C7H14ClNO4 and a molecular weight of 211.64 g/mol. IUPAC name: 4-aminoheptanedioic acid;hydrochloride. InChIKey: JWQBFRWDIHLWMV-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 4-aminoheptanedioic acid;hydrochloride |
| InChIKey | JWQBFRWDIHLWMV-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C(CCC(=O)O)N.Cl |
Computed by PubChem (NCBI)