CAS 1823000-08-3 is the registry number for Ethyl 3-Amino-2,6-dibromoisonicotinate. Offered by: TRC. Available pack sizes: 5g.
Ethyl 3-amino-2,6-dibromopyridine-4-carboxylate (CAS 1823000-08-3) is a chemical compound with the molecular formula C8H8Br2N2O2 and a molecular weight of 323.97 g/mol. IUPAC name: ethyl 3-amino-2,6-dibromopyridine-4-carboxylate. InChIKey: LVEQLUVVTXALJW-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2O2 |
|---|---|
| Molecular weight | 323.97 g/mol |
| IUPAC name | ethyl 3-amino-2,6-dibromopyridine-4-carboxylate |
| InChIKey | LVEQLUVVTXALJW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1N)Br)Br |
Computed by PubChem (NCBI)