Products 2788911-79-3
CAS 2788911-79-3 is the registry number for Ethyl 3,6-dibromo-5-methylpyrazine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3,6-dibromo-5-methylpyrazine-2-carboxylate (CAS 2788911-79-3) is a chemical compound with the molecular formula C8H8Br2N2O2 and a molecular weight of 323.97 g/mol. IUPAC name: ethyl 3,6-dibromo-5-methylpyrazine-2-carboxylate. InChIKey: DGKPNUFFDWQFKZ-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2O2 |
|---|---|
| Molecular weight | 323.97 g/mol |
| IUPAC name | ethyl 3,6-dibromo-5-methylpyrazine-2-carboxylate |
| InChIKey | DGKPNUFFDWQFKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(N=C1Br)C)Br |
Computed by PubChem (NCBI)