CAS 31419-81-5 appears in our catalog under these names: 3,5-Dibromo-N'-hydroxy-4-methoxybenzimidamide, 97%, 3,5-Dibromo-4-methoxybenzamidoxime. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
3,5-dibromo-N'-hydroxy-4-methoxybenzenecarboximidamide (CAS 31419-81-5) is a chemical compound with the molecular formula C8H8Br2N2O2 and a molecular weight of 323.97 g/mol. IUPAC name: 3,5-dibromo-N'-hydroxy-4-methoxybenzenecarboximidamide. InChIKey: KDCMGKXESJFOMD-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2O2 |
|---|---|
| Molecular weight | 323.97 g/mol |
| IUPAC name | 3,5-dibromo-N'-hydroxy-4-methoxybenzenecarboximidamide |
| InChIKey | KDCMGKXESJFOMD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)/C(=N/O)/N)Br |
Computed by PubChem (NCBI)