Products 1823068-83-2

CAS 1823068-83-2 is the registry number for 7-Chloro-8-fluorochromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-chloro-8-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1823068-83-2) is a chemical compound with the molecular formula C10H8ClFO3 and a molecular weight of 230.62 g/mol. IUPAC name: 7-chloro-8-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: OVVYVLNFODSUFD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClFO3
Molecular weight230.62 g/mol
IUPAC name7-chloro-8-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyOVVYVLNFODSUFD-UHFFFAOYSA-N
SMILESC1C(COC2=C1C=CC(=C2F)Cl)C(=O)O

Computed by PubChem (NCBI)