CAS 1823092-22-3 is the registry number for Methyl 8-methylchromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 8-methyl-3,4-dihydro-2H-chromene-3-carboxylate (CAS 1823092-22-3) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: methyl 8-methyl-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: AVVOXDIVKXESRG-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | methyl 8-methyl-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | AVVOXDIVKXESRG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)CC(CO2)C(=O)OC |
Computed by PubChem (NCBI)