CAS 1823230-79-0 is the registry number for tert–Butyl tetrahydro–2H–pyrrolo(3,4–d)isothiazole–5(3H)–carboxylate 1,1–dioxide. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl 1,1-dioxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]thiazole-5-carboxylate (CAS 1823230-79-0) is a chemical compound with the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. IUPAC name: tert-butyl 1,1-dioxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]thiazole-5-carboxylate. InChIKey: REYRCSJRCYPTTR-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O4S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | tert-butyl 1,1-dioxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]thiazole-5-carboxylate |
| InChIKey | REYRCSJRCYPTTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CNS(=O)(=O)C2C1 |
Computed by PubChem (NCBI)