CAS 2375273-36-0 appears in our catalog under these names: tert-Butyl 6-thia-2,7-diazaspiro(3.4)octane-2-carboxylate 6,6-dioxide, 98%, tert-Butyl 6,6-dioxo-6λ6-thia-2,7-diazaspiro(3.4)octane-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl 6,6-dioxo-6lambda6-thia-2,7-diazaspiro[3.4]octane-2-carboxylate (CAS 2375273-36-0) is a chemical compound with the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. IUPAC name: tert-butyl 6,6-dioxo-6lambda6-thia-2,7-diazaspiro[3.4]octane-2-carboxylate. InChIKey: LXRFSHKVRLSEDC-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O4S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | tert-butyl 6,6-dioxo-6lambda6-thia-2,7-diazaspiro[3.4]octane-2-carboxylate |
| InChIKey | LXRFSHKVRLSEDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CNS(=O)(=O)C2 |
Computed by PubChem (NCBI)