Products 6065-27-6
CAS 6065-27-6 is the registry number for N1,N1-Diethylbenzene-1,4-diamine xsulfate, 98%, 98%. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 500g.
4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid (CAS 6065-27-6) is a chemical compound with the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. IUPAC name: 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid. InChIKey: AYLDJQABCMPYEN-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O4S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid |
| InChIKey | AYLDJQABCMPYEN-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
N,N-Diethyl-p-phenylenediamine sulfate, Diethyl-p-phenylenediamine sulfate, N,N-Diethyl-1,4-phenylenediamine sulfate, N,N-Diethyl-p-phenylenediamine sulfate salt, p-Amino-N,N-diethylaniline sulfate, N,N-Diethyl-1,4-benzenediamine sulfate, Siran N,N-diethyl-p-fenylendiaminu, N,N-Diethylbenzene-1,4-diammonium sulphate, Siran N,N-diethyl-p-fenylendiaminu [Czech], 1,4-Benzenediamine, N,N-diethyl-, sulfate