CAS 1823314-40-4 is the registry number for 6-Bromocinnolin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromocinnolin-4-amine (CAS 1823314-40-4) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 6-bromocinnolin-4-amine. InChIKey: VDMWPZRZGPXSFJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 6-bromocinnolin-4-amine |
| InChIKey | VDMWPZRZGPXSFJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN=N2)N |
Computed by PubChem (NCBI)