Products 1823316-43-3

CAS 1823316-43-3 is the registry number for 4-bromo-3-ethoxy-2-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.

Structural formula: {0} (CAS {1})

4-bromo-3-ethoxy-2-fluorobenzoic acid (CAS 1823316-43-3) is a chemical compound with the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. IUPAC name: 4-bromo-3-ethoxy-2-fluorobenzoic acid. InChIKey: JANOXBFAXXRLJA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrFO3
Molecular weight263.06 g/mol
IUPAC name4-bromo-3-ethoxy-2-fluorobenzoic acid
InChIKeyJANOXBFAXXRLJA-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1F)C(=O)O)Br

Computed by PubChem (NCBI)