CAS 1823322-87-7 is the registry number for 1-(4-bromo-2-fluorophenyl)-2,2-dichloroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-2-fluorophenyl)-2,2-dichloroethanone (CAS 1823322-87-7) is a chemical compound with the molecular formula C8H4BrCl2FO and a molecular weight of 285.92 g/mol. IUPAC name: 1-(4-bromo-2-fluorophenyl)-2,2-dichloroethanone. InChIKey: ULYKMWMPMTXXDX-UHFFFAOYSA-N.
| Molecular formula | C8H4BrCl2FO |
|---|---|
| Molecular weight | 285.92 g/mol |
| IUPAC name | 1-(4-bromo-2-fluorophenyl)-2,2-dichloroethanone |
| InChIKey | ULYKMWMPMTXXDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)C(Cl)Cl |
Computed by PubChem (NCBI)