CAS 618441-98-8 is the registry number for 2-Bromo-1-(3,5-dichloro-2-fluorophenyl)ethanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(3,5-dichloro-2-fluorophenyl)ethanone (CAS 618441-98-8) is a chemical compound with the molecular formula C8H4BrCl2FO and a molecular weight of 285.92 g/mol. IUPAC name: 2-bromo-1-(3,5-dichloro-2-fluorophenyl)ethanone. InChIKey: MOMGBDKPHFILQZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrCl2FO |
|---|---|
| Molecular weight | 285.92 g/mol |
| IUPAC name | 2-bromo-1-(3,5-dichloro-2-fluorophenyl)ethanone |
| InChIKey | MOMGBDKPHFILQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)CBr)F)Cl)Cl |
Computed by PubChem (NCBI)