CAS 357915-19-6 is the registry number for 2-Bromo-1-(2,4-dichloro-5-fluorophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(2,4-dichloro-5-fluorophenyl)ethanone (CAS 357915-19-6) is a chemical compound with the molecular formula C8H4BrCl2FO and a molecular weight of 285.92 g/mol. IUPAC name: 2-bromo-1-(2,4-dichloro-5-fluorophenyl)ethanone. InChIKey: NKGIJJGWTNSVQB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrCl2FO |
|---|---|
| Molecular weight | 285.92 g/mol |
| IUPAC name | 2-bromo-1-(2,4-dichloro-5-fluorophenyl)ethanone |
| InChIKey | NKGIJJGWTNSVQB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)Cl)C(=O)CBr |
Computed by PubChem (NCBI)