CAS 1823332-95-1 appears in our catalog under these names: 5-Bromo-2,6-dimethoxypyridine-3-carbaldehyde, 95%, 5-Bromo-2,6-dimethoxypyridine-3-carbaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
5-bromo-2,6-dimethoxypyridine-3-carbaldehyde (CAS 1823332-95-1) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 5-bromo-2,6-dimethoxypyridine-3-carbaldehyde. InChIKey: PXGQJVSZKYEKNP-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 5-bromo-2,6-dimethoxypyridine-3-carbaldehyde |
| InChIKey | PXGQJVSZKYEKNP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)C=O)Br |
Computed by PubChem (NCBI)