CAS 1823402-51-2 is the registry number for 4-Bromo-3,5-dimethylbenzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-3,5-dimethylbenzohydrazide (CAS 1823402-51-2) is a chemical compound with the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. IUPAC name: 4-bromo-3,5-dimethylbenzohydrazide. InChIKey: UMDQOTZIYDCUKE-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 4-bromo-3,5-dimethylbenzohydrazide |
| InChIKey | UMDQOTZIYDCUKE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C(=O)NN |
Computed by PubChem (NCBI)