Products 1823413-49-5
CAS 1823413-49-5 appears in our catalog under these names: Amisulpride Impurity 15, Amisulpride Impurity 12, Amisulpride Impurity 21, Amisulpride Impurity 33. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 4-amino-2-hydroxy-5-thiocyanatobenzoate (CAS 1823413-49-5) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: methyl 4-amino-2-hydroxy-5-thiocyanatobenzoate. InChIKey: AZBAJFCAMYFNRE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | methyl 4-amino-2-hydroxy-5-thiocyanatobenzoate |
| InChIKey | AZBAJFCAMYFNRE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)N)SC#N |
Computed by PubChem (NCBI)