Products 1823440-65-8

CAS 1823440-65-8 is the registry number for 2-(2-Ethyl-2H-1,2,3-triazol-4-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-ethyltriazol-4-yl)acetic acid (CAS 1823440-65-8) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: 2-(2-ethyltriazol-4-yl)acetic acid. InChIKey: WYQPRUZQVMWMST-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3O2
Molecular weight155.15 g/mol
IUPAC name2-(2-ethyltriazol-4-yl)acetic acid
InChIKeyWYQPRUZQVMWMST-UHFFFAOYSA-N
SMILESCCN1N=CC(=N1)CC(=O)O

Computed by PubChem (NCBI)