Products 1823583-23-8
CAS 1823583-23-8 is the registry number for 5H-​Pyrrolo(3,​4-​d)​thiazole-​5-​carboxylic acid, 2-​amino-​4,​6-​dihydro-​4,​4-​dimethyl-​, 1,​1-​dimethylethyl ester. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 2-amino-4,4-dimethyl-6H-pyrrolo[3,4-d][1,3]thiazole-5-carboxylate (CAS 1823583-23-8) is a chemical compound with the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. IUPAC name: tert-butyl 2-amino-4,4-dimethyl-6H-pyrrolo[3,4-d][1,3]thiazole-5-carboxylate. InChIKey: SDWKFTLJSJORSD-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2S |
|---|---|
| Molecular weight | 269.37 g/mol |
| IUPAC name | tert-butyl 2-amino-4,4-dimethyl-6H-pyrrolo[3,4-d][1,3]thiazole-5-carboxylate |
| InChIKey | SDWKFTLJSJORSD-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CN1C(=O)OC(C)(C)C)SC(=N2)N)C |
Computed by PubChem (NCBI)