CAS 1823835-30-8 is the registry number for Tert–Butyl 2,3–Dioxo–2,3–Dihydrospiro(Indene–1,4–Piperidine)–1–Carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl 2',3-dioxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (CAS 1823835-30-8) is a chemical compound with the molecular formula C18H21NO4 and a molecular weight of 315.4 g/mol. IUPAC name: tert-butyl 2',3-dioxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate. InChIKey: KHQVVXGQJSGBCZ-UHFFFAOYSA-N.
| Molecular formula | C18H21NO4 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | tert-butyl 2',3-dioxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| InChIKey | KHQVVXGQJSGBCZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC(=O)C3=CC=CC=C32)CC1=O |
Computed by PubChem (NCBI)