Products 1823888-29-4

CAS 1823888-29-4 is the registry number for Methyl 3-bromo-2-ethoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-bromo-2-ethoxybenzoate (CAS 1823888-29-4) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 3-bromo-2-ethoxybenzoate. InChIKey: MXBQFQYZSDOGHL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO3
Molecular weight259.10 g/mol
IUPAC namemethyl 3-bromo-2-ethoxybenzoate
InChIKeyMXBQFQYZSDOGHL-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC=C1Br)C(=O)OC

Computed by PubChem (NCBI)