CAS 1823967-74-3 appears in our catalog under these names: 3-(hydroxymethyl)-1H-pyrazole-1-carboxylic acid 1,1-dimethylethyl ester, 97%, 97%, 3-(HYDROXYMETHYL)-1H-PYRAZOLE-1-CARBOXYLIC ACID 1,1-DIMETHYLETHYL ESTER, 97%, tert-Butyl 3-(hydroxymethyl)-1H-pyrazole-1-carboxylate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(hydroxymethyl)pyrazole-1-carboxylate (CAS 1823967-74-3) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 3-(hydroxymethyl)pyrazole-1-carboxylate. InChIKey: IVSAARZGKHAONE-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 3-(hydroxymethyl)pyrazole-1-carboxylate |
| InChIKey | IVSAARZGKHAONE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC(=N1)CO |
Computed by PubChem (NCBI)