CAS 1824056-49-6 is the registry number for Methyl 2,3-difluoro-4-iodobenzoate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2,3-difluoro-4-iodobenzoate (CAS 1824056-49-6) is a chemical compound with the molecular formula C8H5F2IO2 and a molecular weight of 298.02 g/mol. IUPAC name: methyl 2,3-difluoro-4-iodobenzoate. InChIKey: DGIHTZGPYOSLIO-UHFFFAOYSA-N.
| Molecular formula | C8H5F2IO2 |
|---|---|
| Molecular weight | 298.02 g/mol |
| IUPAC name | methyl 2,3-difluoro-4-iodobenzoate |
| InChIKey | DGIHTZGPYOSLIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)I)F)F |
Computed by PubChem (NCBI)