CAS 479090-50-1 is the registry number for 2,5–Difluoro–4–iodo–3–methyl–benzoic acid. Offered by: GLPBio. Available pack sizes: 1g.
2,5-difluoro-4-iodo-3-methylbenzoic acid (CAS 479090-50-1) is a chemical compound with the molecular formula C8H5F2IO2 and a molecular weight of 298.02 g/mol. IUPAC name: 2,5-difluoro-4-iodo-3-methylbenzoic acid. InChIKey: KGNMYMFDJJBKQA-UHFFFAOYSA-N.
| Molecular formula | C8H5F2IO2 |
|---|---|
| Molecular weight | 298.02 g/mol |
| IUPAC name | 2,5-difluoro-4-iodo-3-methylbenzoic acid |
| InChIKey | KGNMYMFDJJBKQA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1I)F)C(=O)O)F |
Computed by PubChem (NCBI)