Products 2768258-39-3
CAS 2768258-39-3 is the registry number for 2,4-Difluoro-3-iodo-6-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-difluoro-3-iodo-6-methylbenzoic acid (CAS 2768258-39-3) is a chemical compound with the molecular formula C8H5F2IO2 and a molecular weight of 298.02 g/mol. IUPAC name: 2,4-difluoro-3-iodo-6-methylbenzoic acid. InChIKey: BDQKRJLNSMIYQP-UHFFFAOYSA-N.
| Molecular formula | C8H5F2IO2 |
|---|---|
| Molecular weight | 298.02 g/mol |
| IUPAC name | 2,4-difluoro-3-iodo-6-methylbenzoic acid |
| InChIKey | BDQKRJLNSMIYQP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)O)F)I)F |
Computed by PubChem (NCBI)
Synonyms:
2,4-Difluoro-3-iodo-6-methylbenzoic acid