Products 1824089-07-7
CAS 1824089-07-7 is the registry number for tert-Butyl 3-[(benzenesulfonyl)methylidene]azetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(benzenesulfonylmethylidene)azetidine-1-carboxylate (CAS 1824089-07-7) is a chemical compound with the molecular formula C15H19NO4S and a molecular weight of 309.4 g/mol. IUPAC name: tert-butyl 3-(benzenesulfonylmethylidene)azetidine-1-carboxylate. InChIKey: DYEUNEKVZVEZEE-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4S |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | tert-butyl 3-(benzenesulfonylmethylidene)azetidine-1-carboxylate |
| InChIKey | DYEUNEKVZVEZEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=CS(=O)(=O)C2=CC=CC=C2)C1 |
Computed by PubChem (NCBI)