CAS 2738672-38-1 is the registry number for (Z)-1,4-Diisopropoxy-1,4-dioxo-3-(pyridin-1-ium-1-yl)but-2-ene-2-thiolate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dioxo-1,4-di(propan-2-yloxy)-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate (CAS 2738672-38-1) is a chemical compound with the molecular formula C15H19NO4S and a molecular weight of 309.4 g/mol. IUPAC name: 1,4-dioxo-1,4-di(propan-2-yloxy)-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate. InChIKey: ICBPJJXPUOOHIQ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4S |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 1,4-dioxo-1,4-di(propan-2-yloxy)-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate |
| InChIKey | ICBPJJXPUOOHIQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(=C(C(=O)OC(C)C)[S-])[N+]1=CC=CC=C1 |
Computed by PubChem (NCBI)