Products 2383690-72-8
CAS 2383690-72-8 is the registry number for Benzyl 1-((methylsulfonyl)methyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 1-(methylsulfonylmethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 2383690-72-8) is a chemical compound with the molecular formula C15H19NO4S and a molecular weight of 309.4 g/mol. IUPAC name: benzyl 1-(methylsulfonylmethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: NJAOUXKULUEILW-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4S |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | benzyl 1-(methylsulfonylmethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | NJAOUXKULUEILW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC12CC1CN(C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)