Products 1824298-12-5
CAS 1824298-12-5 is the registry number for 5-(Dimethylcarbamoyl)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(dimethylcarbamoyl)pyridine-3-carboxylic acid (CAS 1824298-12-5) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 5-(dimethylcarbamoyl)pyridine-3-carboxylic acid. InChIKey: CVQPJCDDHLLLJY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 5-(dimethylcarbamoyl)pyridine-3-carboxylic acid |
| InChIKey | CVQPJCDDHLLLJY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CN=C1)C(=O)O |
Computed by PubChem (NCBI)