Products 1824301-72-5

CAS 1824301-72-5 is the registry number for 4-Amino-6-chlorochromane-8-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylic acid (CAS 1824301-72-5) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: 4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylic acid. InChIKey: MUIYONBMPBAYMS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO3
Molecular weight227.64 g/mol
IUPAC name4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylic acid
InChIKeyMUIYONBMPBAYMS-UHFFFAOYSA-N
SMILESC1COC2=C(C1N)C=C(C=C2C(=O)O)Cl

Computed by PubChem (NCBI)