CAS 1824465-17-9 appears in our catalog under these names: 4-(1-Cyanocyclopentyl)benzoic acid, 98%, 4-(1-Cyanocyclopentyl)benzoic acid, 96%, 96%, 4-(1-Cyanocyclopentyl)benzoic acid, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-(1-cyanocyclopentyl)benzoic acid (CAS 1824465-17-9) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 4-(1-cyanocyclopentyl)benzoic acid. InChIKey: HYBJWAMYZSJXLL-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 4-(1-cyanocyclopentyl)benzoic acid |
| InChIKey | HYBJWAMYZSJXLL-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C#N)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)