Products 1824521-03-0
CAS 1824521-03-0 is the registry number for 3-{((tert-Butoxy)carbonyl)amino}-2,2,4-trimethylpentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2,4-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1824521-03-0) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: 2,2,4-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: JOXATCFVTUFRBX-UHFFFAOYSA-N.
| Molecular formula | C13H25NO4 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | 2,2,4-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | JOXATCFVTUFRBX-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(C)(C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)