CAS 18247-32-0 appears in our catalog under these names: 2-Chloro-4-methyl-6-phenoxypyrimidine, 95%, 2-Chloro-4-methyl-6-phenoxypyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-chloro-4-methyl-6-phenoxypyrimidine (CAS 18247-32-0) is a chemical compound with the molecular formula C11H9ClN2O and a molecular weight of 220.65 g/mol. IUPAC name: 2-chloro-4-methyl-6-phenoxypyrimidine. InChIKey: SMIVOTFQHQYUMO-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 2-chloro-4-methyl-6-phenoxypyrimidine |
| InChIKey | SMIVOTFQHQYUMO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)Cl)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)