CAS 182482-25-3 appears in our catalog under these names: 2,4,6–Trifluorobenzeneboronic Acid (contains varying amounts of Anhydride), 2,4,6-Trifluorobenzeneboronic acid, 97% , 2,4,6-Trifluorophenylboronic Acid (contains varying amounts of Anhydride), 2,4,6-Trifluorophenylboronic acid, 95%, 2,4,6-Trifluorophenylboronic Acid, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 500g, 100g.
(2,4,6-trifluorophenyl)boronic acid (CAS 182482-25-3) is a chemical compound with the molecular formula C6H4BF3O2 and a molecular weight of 175.90 g/mol. IUPAC name: (2,4,6-trifluorophenyl)boronic acid. InChIKey: IPEIGKHHSZFAEW-UHFFFAOYSA-N.
| Molecular formula | C6H4BF3O2 |
|---|---|
| Molecular weight | 175.90 g/mol |
| IUPAC name | (2,4,6-trifluorophenyl)boronic acid |
| InChIKey | IPEIGKHHSZFAEW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)F)F)(O)O |
Computed by PubChem (NCBI)