CAS 247564-71-2 appears in our catalog under these names: 2,3,6–Trifluorophenylboronic acid, 2,3,6-Trifluorophenylboronic acid, 98%, 98%, 2,3,6-Trifluorobenzeneboronic acid, 98%, 2,3,6-Trifluorophenylboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
(2,3,6-trifluorophenyl)boronic acid (CAS 247564-71-2) is a chemical compound with the molecular formula C6H4BF3O2 and a molecular weight of 175.90 g/mol. IUPAC name: (2,3,6-trifluorophenyl)boronic acid. InChIKey: IWPDDRPLEKURGG-UHFFFAOYSA-N.
| Molecular formula | C6H4BF3O2 |
|---|---|
| Molecular weight | 175.90 g/mol |
| IUPAC name | (2,3,6-trifluorophenyl)boronic acid |
| InChIKey | IWPDDRPLEKURGG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)F)(O)O |
Computed by PubChem (NCBI)