Products 247564-73-4
CAS 247564-73-4 appears in our catalog under these names: 2,3,5–Trifluorophenylboronic acid(contains varying amounts of Anhydride), 2,3,5-Trifluorophenylboronic Acid (contains varying amounts of Anhydride), 2,3,5-Trifluorophenylboronic acid 98%, Boronic acid, B-(2,3,5-trifluorophenyl)-, 98%, 98%, 2,3,5-Trifluorophenylboronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 10g, 50g.
(2,3,5-trifluorophenyl)boronic acid (CAS 247564-73-4) is a chemical compound with the molecular formula C6H4BF3O2 and a molecular weight of 175.90 g/mol. IUPAC name: (2,3,5-trifluorophenyl)boronic acid. InChIKey: IRMUMGKQAXLGHK-UHFFFAOYSA-N.
| Molecular formula | C6H4BF3O2 |
|---|---|
| Molecular weight | 175.90 g/mol |
| IUPAC name | (2,3,5-trifluorophenyl)boronic acid |
| InChIKey | IRMUMGKQAXLGHK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3,5-Trifluorophenylboronic acid, (2,3,5-trifluorophenyl)boronic Acid, 2,3,5-Trifluorobenzeneboronic Acid, 2,3,5-Trifluorophenylboronic acid, >=95%, 2,3,5-Trifluorophenylboronicacid, (2,3,5-triflu, IRMUMGKQAXLGHK-UHFFFAOYSA-N, B-(2,3,5-Trifluorophenyl)boronic acid, Boronic acid, B-?(2,?3,?5-?trifluorophenyl)?-, 2,3,5-Trifluorophenylboronic acid(contains varying amounts of Anhydride)